C24H32 — CID 143048356
1-[(E)-4,4-dimethylpent-2-en-2-yl]-4-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]benzene (PubChem CID 143048356) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-[(E)-4,4-dimethylpent-2-en-2-yl]-4-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]benzene.
| Compound Name | 1-[(E)-4,4-dimethylpent-2-en-2-yl]-4-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]benzene |
|---|---|
| PubChem CID | 143048356 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-[(E)-4,4-dimethylpent-2-en-2-yl]-4-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]benzene |
| SMILES | C=C/C(=C\C=C/C)CCC(=C)c1ccc(/C(C)=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32/c1-8-10-11-21(9-2)13-12-19(3)22-14-16-23(17-15-22)20(4)18-24(5,6)7/h8-11,14-18H,2-3,12-13H2,1,4-7H3/b10-8-,20-18+,21-11+ |
| InChIKey | DLFLMUHAENPDBA-NRFYTVAESA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|