About 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine
4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine (PubChem CID 143049564) has the molecular formula C13H20FN
and a molecular weight of 209.31 g/mol. Its IUPAC name is 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine |
| PubChem CID | 143049564 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine |
| SMILES | C=C/C=C(\C=C)CC1CCC(NF)CC1 |
| InChI | InChI=1S/C13H20FN/c1-3-5-11(4-2)10-12-6-8-13(15-14)9-7-12/h3-5,12-13,15H,1-2,6-10H2/b11-5+ |
| InChIKey | UKRMFLVJBDZCCY-VZUCSPMQSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine?
The IUPAC name of 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine (CID 143049564) is 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine.
What is the SMILES notation for 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine?
The canonical SMILES for 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine is C=C/C=C(\C=C)CC1CCC(NF)CC1.
What is the InChIKey of 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine?
The InChIKey is UKRMFLVJBDZCCY-VZUCSPMQSA-N. The full InChI is InChI=1S/C13H20FN/c1-3-5-11(4-2)10-12-6-8-13(15-14)9-7-12/h3-5,12-13,15H,1-2,6-10H2/b11-5+.
What are the key properties of 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine?
4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine has a molecular weight of 209.31 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-fluorocyclohexan-1-amine is sourced from PubChem (CID 143049564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).