About 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane
3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane (PubChem CID 143050352) has the molecular formula C8H15F3N2
and a molecular weight of 196.22 g/mol. Its IUPAC name is 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane |
| PubChem CID | 143050352 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane |
| SMILES | CC(C)NCCC#N.CC(F)(F)F |
| InChI | InChI=1S/C6H12N2.C2H3F3/c1-6(2)8-5-3-4-7;1-2(3,4)5/h6,8H,3,5H2,1-2H3;1H3 |
| InChIKey | SKVYAJANSRENKZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane?
The IUPAC name of 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane (CID 143050352) is 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane.
What is the SMILES notation for 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane?
The canonical SMILES for 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane is CC(C)NCCC#N.CC(F)(F)F.
What is the InChIKey of 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane?
The InChIKey is SKVYAJANSRENKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C2H3F3/c1-6(2)8-5-3-4-7;1-2(3,4)5/h6,8H,3,5H2,1-2H3;1H3.
What are the key properties of 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane?
3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane has a molecular weight of 196.22 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propan-2-ylamino)propanenitrile;1,1,1-trifluoroethane is sourced from PubChem (CID 143050352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).