C29H28F3N7O2 — CID 143051028
3-[2-[[3-[8-(pyridin-4-ylmethylamino)imidazo[1,2-a]pyrazin-6-yl]anilino]methylamino]-4-(trifluoromethyl)phenoxy]propan-1-ol (PubChem CID 143051028) has the molecular formula C29H28F3N7O2 and a molecular weight of 563.58 g/mol. Its IUPAC name is 3-[2-[[3-[8-(pyridin-4-ylmethylamino)imidazo[1,2-a]pyrazin-6-yl]anilino]methylamino]-4-(trifluoromethyl)phenoxy]propan-1-ol.
| Compound Name | 3-[2-[[3-[8-(pyridin-4-ylmethylamino)imidazo[1,2-a]pyrazin-6-yl]anilino]methylamino]-4-(trifluoromethyl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 143051028 |
| Molecular Formula | C29H28F3N7O2 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 3-[2-[[3-[8-(pyridin-4-ylmethylamino)imidazo[1,2-a]pyrazin-6-yl]anilino]methylamino]-4-(trifluoromethyl)phenoxy]propan-1-ol |
| SMILES | OCCCOc1ccc(C(F)(F)F)cc1NCNc1cccc(-c2cn3ccnc3c(NCc3ccncc3)n2)c1 |
| InChI | InChI=1S/C29H28F3N7O2/c30-29(31,32)22-5-6-26(41-14-2-13-40)24(16-22)37-19-36-23-4-1-3-21(15-23)25-18-39-12-11-34-28(39)27(38-25)35-17-20-7-9-33-10-8-20/h1,3-12,15-16,18,36-37,40H,2,13-14,17,19H2,(H,35,38) |
| InChIKey | ZCWZIIAKEGOHMW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|