C27H35F4N7O — CID 143051625
1-[(1R,2S)-2-[[3-(4-fluorophenyl)propyl-(2,2,2-trifluoroethyl)amino]methyl]cyclohexyl]-3-[3-(1-methyl-2,3-dihydrotetrazol-5-yl)phenyl]urea (PubChem CID 143051625) has the molecular formula C27H35F4N7O and a molecular weight of 549.62 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[[3-(4-fluorophenyl)propyl-(2,2,2-trifluoroethyl)amino]methyl]cyclohexyl]-3-[3-(1-methyl-2,3-dihydrotetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[(1R,2S)-2-[[3-(4-fluorophenyl)propyl-(2,2,2-trifluoroethyl)amino]methyl]cyclohexyl]-3-[3-(1-methyl-2,3-dihydrotetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 143051625 |
| Molecular Formula | C27H35F4N7O |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 1-[(1R,2S)-2-[[3-(4-fluorophenyl)propyl-(2,2,2-trifluoroethyl)amino]methyl]cyclohexyl]-3-[3-(1-methyl-2,3-dihydrotetrazol-5-yl)phenyl]urea |
| SMILES | CN1NNN=C1c1cccc(NC(=O)N[C@@H]2CCCC[C@H]2CN(CCCc2ccc(F)cc2)CC(F)(F)F)c1 |
| InChI | InChI=1S/C27H35F4N7O/c1-37-25(34-35-36-37)20-8-4-9-23(16-20)32-26(39)33-24-10-3-2-7-21(24)17-38(18-27(29,30)31)15-5-6-19-11-13-22(28)14-12-19/h4,8-9,11-14,16,21,24,35-36H,2-3,5-7,10,15,17-18H2,1H3,(H2,32,33,39)/t21-,24+/m0/s1 |
| InChIKey | FQQITCHXWYCPFJ-XUZZJYLKSA-N |
| XLogP | 4.62 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |