About 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane
1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane (PubChem CID 143051679) has the molecular formula C14H23F
and a molecular weight of 210.34 g/mol. Its IUPAC name is 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane.
Molecular Properties
| Compound Name | 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane |
| PubChem CID | 143051679 |
| Molecular Formula | C14H23F |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane |
| SMILES | CC.CCC(C)(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17F.C2H6/c1-4-12(2,3)9-10-5-7-11(13)8-6-10;1-2/h5-8H,4,9H2,1-3H3;1-2H3 |
| InChIKey | WLEPNNYMCFCQIU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane?
The IUPAC name of 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane (CID 143051679) is 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane.
What is the SMILES notation for 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane?
The canonical SMILES for 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane is CC.CCC(C)(C)Cc1ccc(F)cc1.
What is the InChIKey of 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane?
The InChIKey is WLEPNNYMCFCQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F.C2H6/c1-4-12(2,3)9-10-5-7-11(13)8-6-10;1-2/h5-8H,4,9H2,1-3H3;1-2H3.
What are the key properties of 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane?
1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane has a molecular weight of 210.34 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylbutyl)-4-fluorobenzene;ethane is sourced from PubChem (CID 143051679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).