About ethane;5-propan-2-yl-3,4-dihydro-2H-pyran
ethane;5-propan-2-yl-3,4-dihydro-2H-pyran (PubChem CID 143052742) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;5-propan-2-yl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | ethane;5-propan-2-yl-3,4-dihydro-2H-pyran |
| PubChem CID | 143052742 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | ethane;5-propan-2-yl-3,4-dihydro-2H-pyran |
| SMILES | CC.CC(C)C1=COCCC1 |
| InChI | InChI=1S/C8H14O.C2H6/c1-7(2)8-4-3-5-9-6-8;1-2/h6-7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | HATOIVYZWYXNFM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-propan-2-yl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-propan-2-yl-3,4-dihydro-2H-pyran?
The IUPAC name of ethane;5-propan-2-yl-3,4-dihydro-2H-pyran (CID 143052742) is ethane;5-propan-2-yl-3,4-dihydro-2H-pyran.
What is the SMILES notation for ethane;5-propan-2-yl-3,4-dihydro-2H-pyran?
The canonical SMILES for ethane;5-propan-2-yl-3,4-dihydro-2H-pyran is CC.CC(C)C1=COCCC1.
What is the InChIKey of ethane;5-propan-2-yl-3,4-dihydro-2H-pyran?
The InChIKey is HATOIVYZWYXNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C2H6/c1-7(2)8-4-3-5-9-6-8;1-2/h6-7H,3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;5-propan-2-yl-3,4-dihydro-2H-pyran?
ethane;5-propan-2-yl-3,4-dihydro-2H-pyran has a molecular weight of 156.27 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-propan-2-yl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 143052742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).