C28H50N2O3 — CID 143053262
(Z)-6-aminooxy-4,7,7-trimethyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]oct-5-en-2-one;ethane (PubChem CID 143053262) has the molecular formula C28H50N2O3 and a molecular weight of 462.72 g/mol. Its IUPAC name is (Z)-6-aminooxy-4,7,7-trimethyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]oct-5-en-2-one;ethane.
| Compound Name | (Z)-6-aminooxy-4,7,7-trimethyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]oct-5-en-2-one;ethane |
|---|---|
| PubChem CID | 143053262 |
| Molecular Formula | C28H50N2O3 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.38 |
| IUPAC Name | (Z)-6-aminooxy-4,7,7-trimethyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]oct-5-en-2-one;ethane |
| SMILES | CC.CC.CC(/C=C(\ON)C(C)(C)C)CC(=O)Cc1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H38N2O3.2C2H6/c1-19(17-23(29-25)24(2,3)4)16-21(27)18-20-8-10-22(11-9-20)28-15-14-26-12-6-5-7-13-26;2*1-2/h8-11,17,19H,5-7,12-16,18,25H2,1-4H3;2*1-2H3/b23-17-;; |
| InChIKey | KOKSIJZQRZWMBI-PKJXIURQSA-N |
| XLogP | 6.56 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|