C19H32N2O — CID 143053425
(E)-N-cyclohexa-1,5-dien-1-yl-5,6,6-trimethyl-3-methyliminohept-4-enamide;ethane (PubChem CID 143053425) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is (E)-N-cyclohexa-1,5-dien-1-yl-5,6,6-trimethyl-3-methyliminohept-4-enamide;ethane.
| Compound Name | (E)-N-cyclohexa-1,5-dien-1-yl-5,6,6-trimethyl-3-methyliminohept-4-enamide;ethane |
|---|---|
| PubChem CID | 143053425 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | (E)-N-cyclohexa-1,5-dien-1-yl-5,6,6-trimethyl-3-methyliminohept-4-enamide;ethane |
| SMILES | C/N=C(\C=C(/C)C(C)(C)C)CC(=O)NC1=CCCC=C1.CC |
| InChI | InChI=1S/C17H26N2O.C2H6/c1-13(17(2,3)4)11-15(18-5)12-16(20)19-14-9-7-6-8-10-14;1-2/h7,9-11H,6,8,12H2,1-5H3,(H,19,20);1-2H3/b13-11+,18-15+; |
| InChIKey | CZYDYNWHTXYQLI-KXASSPAMSA-N |
| XLogP | 4.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|