C23H36FNO6 — CID 143053562
(1S,2R,5S,7R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 143053562) has the molecular formula C23H36FNO6 and a molecular weight of 441.54 g/mol. Its IUPAC name is (1S,2R,5S,7R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,2R,5S,7R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 143053562 |
| Molecular Formula | C23H36FNO6 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (1S,2R,5S,7R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CC[C@H]1OC(=O)[C@@](C)(F)C(=O)[C@H](C)CC(C)(C)C[C@@H](C)C(=O)[C@H](C)[C@H]2NC(=O)O[C@@]21C |
| InChI | InChI=1S/C23H36FNO6/c1-9-15-23(8)17(25-20(29)31-23)14(4)16(26)12(2)10-21(5,6)11-13(3)18(27)22(7,24)19(28)30-15/h12-15,17H,9-11H2,1-8H3,(H,25,29)/t12-,13-,14+,15-,17-,22+,23-/m1/s1 |
| InChIKey | XUTWTUUQJIWIQF-KUHRLPPNSA-N |
| XLogP | 3.77 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|