About ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol
ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol (PubChem CID 143054678) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol.
Molecular Properties
| Compound Name | ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol |
| PubChem CID | 143054678 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol |
| SMILES | CC.CCC(O)(CC)C1=CCC(CO)O1 |
| InChI | InChI=1S/C10H18O3.C2H6/c1-3-10(12,4-2)9-6-5-8(7-11)13-9;1-2/h6,8,11-12H,3-5,7H2,1-2H3;1-2H3 |
| InChIKey | OGLQYWXAYLZEMJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol?
The IUPAC name of ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol (CID 143054678) is ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol.
What is the SMILES notation for ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol?
The canonical SMILES for ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol is CC.CCC(O)(CC)C1=CCC(CO)O1.
What is the InChIKey of ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol?
The InChIKey is OGLQYWXAYLZEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C2H6/c1-3-10(12,4-2)9-6-5-8(7-11)13-9;1-2/h6,8,11-12H,3-5,7H2,1-2H3;1-2H3.
What are the key properties of ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol?
ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol has a molecular weight of 216.32 g/mol, XLogP of 2.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[2-(hydroxymethyl)-2,3-dihydrofuran-5-yl]pentan-3-ol is sourced from PubChem (CID 143054678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).