C29H42N2O6S — CID 143054822
(1Z)-buta-1,3-diene-1-thiol;methanol;propyl 5-[2-(2-ethyl-5-methyl-1,3-oxazol-4-yl)ethoxy]-8-(3-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 143054822) has the molecular formula C29H42N2O6S and a molecular weight of 546.73 g/mol. Its IUPAC name is (1Z)-buta-1,3-diene-1-thiol;methanol;propyl 5-[2-(2-ethyl-5-methyl-1,3-oxazol-4-yl)ethoxy]-8-(3-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | (1Z)-buta-1,3-diene-1-thiol;methanol;propyl 5-[2-(2-ethyl-5-methyl-1,3-oxazol-4-yl)ethoxy]-8-(3-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 143054822 |
| Molecular Formula | C29H42N2O6S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | (1Z)-buta-1,3-diene-1-thiol;methanol;propyl 5-[2-(2-ethyl-5-methyl-1,3-oxazol-4-yl)ethoxy]-8-(3-oxopropyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=C/C=C\S.CCCOC(=O)N1CCc2c(OCCc3nc(CC)oc3C)ccc(CCC=O)c2C1.CO |
| InChI | InChI=1S/C24H32N2O5.C4H6S.CH4O/c1-4-14-30-24(28)26-12-10-19-20(16-26)18(7-6-13-27)8-9-22(19)29-15-11-21-17(3)31-23(5-2)25-21;1-2-3-4-5;1-2/h8-9,13H,4-7,10-12,14-16H2,1-3H3;2-5H,1H2;2H,1H3/b;4-3-; |
| InChIKey | QJCVDBZKZPGBIY-LWFKIUJUSA-N |
| XLogP | 5.43 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|