About 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride
2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride (PubChem CID 143055002) has the molecular formula C8H5ClF2O
and a molecular weight of 190.58 g/mol. Its IUPAC name is 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride |
| PubChem CID | 143055002 |
| Molecular Formula | C8H5ClF2O |
| Molecular Weight | 190.58 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride |
| SMILES | O=C(Cl)C1=C(F)C=CCC=C1F |
| InChI | InChI=1S/C8H5ClF2O/c9-8(12)7-5(10)3-1-2-4-6(7)11/h1,3-4H,2H2 |
| InChIKey | DARFZCMIPHOSBJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride?
The IUPAC name of 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride (CID 143055002) is 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride.
What is the SMILES notation for 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride?
The canonical SMILES for 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride is O=C(Cl)C1=C(F)C=CCC=C1F.
What is the InChIKey of 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride?
The InChIKey is DARFZCMIPHOSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF2O/c9-8(12)7-5(10)3-1-2-4-6(7)11/h1,3-4H,2H2.
What are the key properties of 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride?
2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride has a molecular weight of 190.58 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-difluorocyclohepta-1,3,6-triene-1-carbonyl chloride is sourced from PubChem (CID 143055002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).