About CID 143055728
CID 143055728 (PubChem CID 143055728) has the molecular formula C5H2BBr2N
and a molecular weight of 246.70 g/mol.
Molecular Properties
| Compound Name | CID 143055728 |
| PubChem CID | 143055728 |
| Molecular Formula | C5H2BBr2N |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 244.86 |
| IUPAC Name | — |
| SMILES | [B]c1nc(Br)ccc1Br |
| InChI | InChI=1S/C5H2BBr2N/c6-5-3(7)1-2-4(8)9-5/h1-2H |
| InChIKey | GJVYWYHWCBYSFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 143055728 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143055728?
The IUPAC name of CID 143055728 (CID 143055728) is not available.
What is the SMILES notation for CID 143055728?
The canonical SMILES for CID 143055728 is [B]c1nc(Br)ccc1Br.
What is the InChIKey of CID 143055728?
The InChIKey is GJVYWYHWCBYSFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BBr2N/c6-5-3(7)1-2-4(8)9-5/h1-2H.
What are the key properties of CID 143055728?
CID 143055728 has a molecular weight of 246.70 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143055728 is sourced from PubChem (CID 143055728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).