About acetaldehyde;N-hexan-3-ylethanimine
acetaldehyde;N-hexan-3-ylethanimine (PubChem CID 143056248) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is acetaldehyde;N-hexan-3-ylethanimine.
Molecular Properties
| Compound Name | acetaldehyde;N-hexan-3-ylethanimine |
| PubChem CID | 143056248 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | acetaldehyde;N-hexan-3-ylethanimine |
| SMILES | C/C=N/C(CC)CCC.CC=O |
| InChI | InChI=1S/C8H17N.C2H4O/c1-4-7-8(5-2)9-6-3;1-2-3/h6,8H,4-5,7H2,1-3H3;2H,1H3/b9-6+; |
| InChIKey | XGCQXIUWKDETTH-MLBSPLJJSA-N |
| XLogP | 2.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;N-hexan-3-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;N-hexan-3-ylethanimine?
The IUPAC name of acetaldehyde;N-hexan-3-ylethanimine (CID 143056248) is acetaldehyde;N-hexan-3-ylethanimine.
What is the SMILES notation for acetaldehyde;N-hexan-3-ylethanimine?
The canonical SMILES for acetaldehyde;N-hexan-3-ylethanimine is C/C=N/C(CC)CCC.CC=O.
What is the InChIKey of acetaldehyde;N-hexan-3-ylethanimine?
The InChIKey is XGCQXIUWKDETTH-MLBSPLJJSA-N. The full InChI is InChI=1S/C8H17N.C2H4O/c1-4-7-8(5-2)9-6-3;1-2-3/h6,8H,4-5,7H2,1-3H3;2H,1H3/b9-6+;.
What are the key properties of acetaldehyde;N-hexan-3-ylethanimine?
acetaldehyde;N-hexan-3-ylethanimine has a molecular weight of 171.28 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;N-hexan-3-ylethanimine is sourced from PubChem (CID 143056248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).