C14H19N3 — CID 143058011
(2E,4Z)-hepta-2,4,6-trien-2-amine;4-methylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 143058011) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is (2E,4Z)-hepta-2,4,6-trien-2-amine;4-methylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | (2E,4Z)-hepta-2,4,6-trien-2-amine;4-methylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 143058011 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (2E,4Z)-hepta-2,4,6-trien-2-amine;4-methylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | C=C/C=C\C=C(/C)N.[H]/N=C1\C=CC(C)=C\C1=N/[H] |
| InChI | InChI=1S/C7H8N2.C7H11N/c1-5-2-3-6(8)7(9)4-5;1-3-4-5-6-7(2)8/h2-4,8-9H,1H3;3-6H,1,8H2,2H3/b8-6+,9-7+;5-4-,7-6+ |
| InChIKey | OPQLWOJRYDOPGT-UMVBHLFESA-N |
| XLogP | 3.13 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|