About (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol
(3R,4R)-4-methoxy-2,4-dimethylthian-3-ol (PubChem CID 143058259) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol |
| PubChem CID | 143058259 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol |
| SMILES | CO[C@]1(C)CCSC(C)[C@@H]1O |
| InChI | InChI=1S/C8H16O2S/c1-6-7(9)8(2,10-3)4-5-11-6/h6-7,9H,4-5H2,1-3H3/t6?,7-,8+/m0/s1 |
| InChIKey | MMEQXYHPAMXKEI-ZHFSPANRSA-N |
| XLogP | 1.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol?
The IUPAC name of (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol (CID 143058259) is (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol.
What is the SMILES notation for (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol?
The canonical SMILES for (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol is CO[C@]1(C)CCSC(C)[C@@H]1O.
What is the InChIKey of (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol?
The InChIKey is MMEQXYHPAMXKEI-ZHFSPANRSA-N. The full InChI is InChI=1S/C8H16O2S/c1-6-7(9)8(2,10-3)4-5-11-6/h6-7,9H,4-5H2,1-3H3/t6?,7-,8+/m0/s1.
What are the key properties of (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol?
(3R,4R)-4-methoxy-2,4-dimethylthian-3-ol has a molecular weight of 176.28 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-methoxy-2,4-dimethylthian-3-ol is sourced from PubChem (CID 143058259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).