C15H28Cl2O6P2 — CID 143058585
2-[2,2-bis(chloromethyl)-3-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]propoxy]-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 143058585) has the molecular formula C15H28Cl2O6P2 and a molecular weight of 437.24 g/mol. Its IUPAC name is 2-[2,2-bis(chloromethyl)-3-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]propoxy]-5,5-dimethyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-[2,2-bis(chloromethyl)-3-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]propoxy]-5,5-dimethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 143058585 |
| Molecular Formula | C15H28Cl2O6P2 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 2-[2,2-bis(chloromethyl)-3-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]propoxy]-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(OCC(CCl)(CCl)COP2OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C15H28Cl2O6P2/c1-13(2)7-18-24(19-8-13)22-11-15(5-16,6-17)12-23-25-20-9-14(3,4)10-21-25/h5-12H2,1-4H3 |
| InChIKey | MNMGHNSVFUXCRH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|