C8H8Cl2O — CID 143058593
(2,4-dichlorocyclohepta-1,3,6-trien-1-yl)methanol (PubChem CID 143058593) has the molecular formula C8H8Cl2O and a molecular weight of 191.06 g/mol. Its IUPAC name is (2,4-dichlorocyclohepta-1,3,6-trien-1-yl)methanol.
| Compound Name | (2,4-dichlorocyclohepta-1,3,6-trien-1-yl)methanol |
|---|---|
| PubChem CID | 143058593 |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | (2,4-dichlorocyclohepta-1,3,6-trien-1-yl)methanol |
| SMILES | OCC1=C(Cl)C=C(Cl)CC=C1 |
| InChI | InChI=1S/C8H8Cl2O/c9-7-3-1-2-6(5-11)8(10)4-7/h1-2,4,11H,3,5H2 |
| InChIKey | DXQDJWXSJARNRL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |