C10H23N5O — CID 143058878
3-amino-N-ethyl-3-(methyliminomethylimino)propanamide;N-methylethanamine (PubChem CID 143058878) has the molecular formula C10H23N5O and a molecular weight of 229.33 g/mol. Its IUPAC name is 3-amino-N-ethyl-3-(methyliminomethylimino)propanamide;N-methylethanamine.
| Compound Name | 3-amino-N-ethyl-3-(methyliminomethylimino)propanamide;N-methylethanamine |
|---|---|
| PubChem CID | 143058878 |
| Molecular Formula | C10H23N5O |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 3-amino-N-ethyl-3-(methyliminomethylimino)propanamide;N-methylethanamine |
| SMILES | CCNC.CCNC(=O)C/C(N)=N/C=N/C |
| InChI | InChI=1S/C7H14N4O.C3H9N/c1-3-10-7(12)4-6(8)11-5-9-2;1-3-4-2/h5H,3-4H2,1-2H3,(H,10,12)(H2,8,9,11);4H,3H2,1-2H3 |
| InChIKey | WQQSAZRRPWJOAC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|