About 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde
6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde (PubChem CID 143058959) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde.
Molecular Properties
| Compound Name | 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde |
| PubChem CID | 143058959 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde |
| SMILES | CC1(C=O)C=Cc2ncsc2C=C1 |
| InChI | InChI=1S/C10H9NOS/c1-10(6-12)4-2-8-9(3-5-10)13-7-11-8/h2-7H,1H3 |
| InChIKey | DQHVUCSGAATFKP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde?
The IUPAC name of 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde (CID 143058959) is 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde.
What is the SMILES notation for 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde?
The canonical SMILES for 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde is CC1(C=O)C=Cc2ncsc2C=C1.
What is the InChIKey of 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde?
The InChIKey is DQHVUCSGAATFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c1-10(6-12)4-2-8-9(3-5-10)13-7-11-8/h2-7H,1H3.
What are the key properties of 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde?
6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde has a molecular weight of 191.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylcyclohepta[d][1,3]thiazole-6-carbaldehyde is sourced from PubChem (CID 143058959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).