About (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane
(2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane (PubChem CID 143059028) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane.
Molecular Properties
| Compound Name | (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane |
| PubChem CID | 143059028 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane |
| SMILES | C=C/C=C(C=O)\C=C/CN.CC |
| InChI | InChI=1S/C8H11NO.C2H6/c1-2-4-8(7-10)5-3-6-9;1-2/h2-5,7H,1,6,9H2;1-2H3/b5-3-,8-4+; |
| InChIKey | NEVBNGOPSGGTPF-URFOKCIRSA-N |
| XLogP | 1.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane?
The IUPAC name of (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane (CID 143059028) is (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane.
What is the SMILES notation for (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane?
The canonical SMILES for (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane is C=C/C=C(C=O)\C=C/CN.CC.
What is the InChIKey of (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane?
The InChIKey is NEVBNGOPSGGTPF-URFOKCIRSA-N. The full InChI is InChI=1S/C8H11NO.C2H6/c1-2-4-8(7-10)5-3-6-9;1-2/h2-5,7H,1,6,9H2;1-2H3/b5-3-,8-4+;.
What are the key properties of (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane?
(2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane has a molecular weight of 167.25 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(Z)-3-aminoprop-1-enyl]penta-2,4-dienal;ethane is sourced from PubChem (CID 143059028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).