C23H38N2O2 — CID 143059130
ethane;methanol;4-methylidene-1-[4-(4-prop-1-en-2-ylphenyl)piperazin-1-yl]hexan-1-one (PubChem CID 143059130) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is ethane;methanol;4-methylidene-1-[4-(4-prop-1-en-2-ylphenyl)piperazin-1-yl]hexan-1-one.
| Compound Name | ethane;methanol;4-methylidene-1-[4-(4-prop-1-en-2-ylphenyl)piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 143059130 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | ethane;methanol;4-methylidene-1-[4-(4-prop-1-en-2-ylphenyl)piperazin-1-yl]hexan-1-one |
| SMILES | C=C(CC)CCC(=O)N1CCN(c2ccc(C(=C)C)cc2)CC1.CC.CO |
| InChI | InChI=1S/C20H28N2O.C2H6.CH4O/c1-5-17(4)6-11-20(23)22-14-12-21(13-15-22)19-9-7-18(8-10-19)16(2)3;2*1-2/h7-10H,2,4-6,11-15H2,1,3H3;1-2H3;2H,1H3 |
| InChIKey | BAFLLYVQQXKWJK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|