C23H31N3O2 — CID 143059667
(2E)-N-[[(2S)-1-[3-amino-4-(3-methylphenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-ethenylpenta-2,4-dienamide (PubChem CID 143059667) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2E)-N-[[(2S)-1-[3-amino-4-(3-methylphenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-ethenylpenta-2,4-dienamide.
| Compound Name | (2E)-N-[[(2S)-1-[3-amino-4-(3-methylphenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-ethenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 143059667 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (2E)-N-[[(2S)-1-[3-amino-4-(3-methylphenyl)butanoyl]pyrrolidin-2-yl]methyl]-2-ethenylpenta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C)C(=O)NC[C@@H]1CCCN1C(=O)CC(N)Cc1cccc(C)c1 |
| InChI | InChI=1S/C23H31N3O2/c1-4-8-19(5-2)23(28)25-16-21-11-7-12-26(21)22(27)15-20(24)14-18-10-6-9-17(3)13-18/h4-6,8-10,13,20-21H,1-2,7,11-12,14-16,24H2,3H3,(H,25,28)/b19-8+/t20?,21-/m0/s1 |
| InChIKey | QFPWLCLUOQDQNQ-ZBUDONGLSA-N |
| XLogP | 2.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|