C19H25F3N2O2 — CID 143059735
3-amino-1-[(2S)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 143059735) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-amino-1-[(2S)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-[(2S)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 143059735 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-amino-1-[(2S)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | NC(CC(=O)N1CCC[C@H]1COCC1CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H25F3N2O2/c20-16-9-18(22)17(21)7-13(16)6-14(23)8-19(25)24-5-1-2-15(24)11-26-10-12-3-4-12/h7,9,12,14-15H,1-6,8,10-11,23H2/t14?,15-/m0/s1 |
| InChIKey | CTPYPSLBYQWSTO-LOACHALJSA-N |
| XLogP | 2.78 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|