C26H26N4O5 — CID 143060986
3-[(7-methyl-1H-indazol-5-yl)methyl]-2,5-dioxo-5-(2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)pentanal (PubChem CID 143060986) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[(7-methyl-1H-indazol-5-yl)methyl]-2,5-dioxo-5-(2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)pentanal.
| Compound Name | 3-[(7-methyl-1H-indazol-5-yl)methyl]-2,5-dioxo-5-(2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)pentanal |
|---|---|
| PubChem CID | 143060986 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[(7-methyl-1H-indazol-5-yl)methyl]-2,5-dioxo-5-(2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-yl)pentanal |
| SMILES | Cc1cc(CC(CC(=O)N2CCC3(CC2)OC(=O)Nc2ccccc23)C(=O)C=O)cc2cn[nH]c12 |
| InChI | InChI=1S/C26H26N4O5/c1-16-10-17(12-19-14-27-29-24(16)19)11-18(22(32)15-31)13-23(33)30-8-6-26(7-9-30)20-4-2-3-5-21(20)28-25(34)35-26/h2-5,10,12,14-15,18H,6-9,11,13H2,1H3,(H,27,29)(H,28,34) |
| InChIKey | JXDHAYYSZXOKHU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|