C14H25ClN2O2 — CID 143061391
(2Z,4Z)-3-chloro-6-[3-(hydroxymethyl)piperazin-1-yl]hepta-2,4,6-trien-2-ol;ethane (PubChem CID 143061391) has the molecular formula C14H25ClN2O2 and a molecular weight of 288.82 g/mol. Its IUPAC name is (2Z,4Z)-3-chloro-6-[3-(hydroxymethyl)piperazin-1-yl]hepta-2,4,6-trien-2-ol;ethane.
| Compound Name | (2Z,4Z)-3-chloro-6-[3-(hydroxymethyl)piperazin-1-yl]hepta-2,4,6-trien-2-ol;ethane |
|---|---|
| PubChem CID | 143061391 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2Z,4Z)-3-chloro-6-[3-(hydroxymethyl)piperazin-1-yl]hepta-2,4,6-trien-2-ol;ethane |
| SMILES | C=C(/C=C\C(Cl)=C(/C)O)N1CCNC(CO)C1.CC |
| InChI | InChI=1S/C12H19ClN2O2.C2H6/c1-9(3-4-12(13)10(2)17)15-6-5-14-11(7-15)8-16;1-2/h3-4,11,14,16-17H,1,5-8H2,2H3;1-2H3/b4-3-,12-10-; |
| InChIKey | OVFYJCOSPZEXKE-RYMTYUSESA-N |
| XLogP | 2.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|