About (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine
(2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine (PubChem CID 143061470) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine |
| PubChem CID | 143061470 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine |
| SMILES | [H]/N=C(\C=C(\C)N)C(=C)C=CCN=C(C)C |
| InChI | InChI=1S/C12H19N3/c1-9(2)15-7-5-6-10(3)12(14)8-11(4)13/h5-6,8,14H,3,7,13H2,1-2,4H3/b6-5?,11-8-,14-12+ |
| InChIKey | SSMGCTHJJDKQNU-MBBXPWHNSA-N |
| XLogP | 2.46 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine?
The IUPAC name of (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine (CID 143061470) is (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine.
What is the SMILES notation for (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine?
The canonical SMILES for (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine is [H]/N=C(\C=C(\C)N)C(=C)C=CCN=C(C)C.
What is the InChIKey of (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine?
The InChIKey is SSMGCTHJJDKQNU-MBBXPWHNSA-N. The full InChI is InChI=1S/C12H19N3/c1-9(2)15-7-5-6-10(3)12(14)8-11(4)13/h5-6,8,14H,3,7,13H2,1-2,4H3/b6-5?,11-8-,14-12+.
What are the key properties of (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine?
(2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine has a molecular weight of 205.30 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4-imino-5-methylidene-8-(propan-2-ylideneamino)octa-2,6-dien-2-amine is sourced from PubChem (CID 143061470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).