About 4-ethyl-2-methylpyridine;prop-1-yne
4-ethyl-2-methylpyridine;prop-1-yne (PubChem CID 143061830) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 4-ethyl-2-methylpyridine;prop-1-yne.
Molecular Properties
| Compound Name | 4-ethyl-2-methylpyridine;prop-1-yne |
| PubChem CID | 143061830 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 4-ethyl-2-methylpyridine;prop-1-yne |
| SMILES | C#CC.CCc1ccnc(C)c1 |
| InChI | InChI=1S/C8H11N.C3H4/c1-3-8-4-5-9-7(2)6-8;1-3-2/h4-6H,3H2,1-2H3;1H,2H3 |
| InChIKey | PDQPXACRUKRJMC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-methylpyridine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylpyridine;prop-1-yne?
The IUPAC name of 4-ethyl-2-methylpyridine;prop-1-yne (CID 143061830) is 4-ethyl-2-methylpyridine;prop-1-yne.
What is the SMILES notation for 4-ethyl-2-methylpyridine;prop-1-yne?
The canonical SMILES for 4-ethyl-2-methylpyridine;prop-1-yne is C#CC.CCc1ccnc(C)c1.
What is the InChIKey of 4-ethyl-2-methylpyridine;prop-1-yne?
The InChIKey is PDQPXACRUKRJMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C3H4/c1-3-8-4-5-9-7(2)6-8;1-3-2/h4-6H,3H2,1-2H3;1H,2H3.
What are the key properties of 4-ethyl-2-methylpyridine;prop-1-yne?
4-ethyl-2-methylpyridine;prop-1-yne has a molecular weight of 161.25 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylpyridine;prop-1-yne is sourced from PubChem (CID 143061830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).