About (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile
(3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile (PubChem CID 143061965) has the molecular formula C16H10N2O3
and a molecular weight of 278.27 g/mol. Its IUPAC name is (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile.
Molecular Properties
| Compound Name | (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile |
| PubChem CID | 143061965 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile |
| SMILES | N#Cc1cccc2c1NC(=O)/C2=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C16H10N2O3/c17-8-9-2-1-3-12-13(16(21)18-15(9)12)7-10-6-11(19)4-5-14(10)20/h1-7,19-20H,(H,18,21)/b13-7+ |
| InChIKey | WSHDKLBGSRCVHX-NTUHNPAUSA-N |
| XLogP | 2.46 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile?
The IUPAC name of (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile (CID 143061965) is (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile.
What is the SMILES notation for (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile?
The canonical SMILES for (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile is N#Cc1cccc2c1NC(=O)/C2=C/c1cc(O)ccc1O.
What is the InChIKey of (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile?
The InChIKey is WSHDKLBGSRCVHX-NTUHNPAUSA-N. The full InChI is InChI=1S/C16H10N2O3/c17-8-9-2-1-3-12-13(16(21)18-15(9)12)7-10-6-11(19)4-5-14(10)20/h1-7,19-20H,(H,18,21)/b13-7+.
What are the key properties of (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile?
(3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile has a molecular weight of 278.27 g/mol, XLogP of 2.46, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(2,5-dihydroxyphenyl)methylidene]-2-oxo-1H-indole-7-carbonitrile is sourced from PubChem (CID 143061965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).