C34H53F4N3O — CID 143062154
ethane;3-(fluoromethyl)-N-[[1-[(3E,5E)-3-methyl-5-(1,1,2-trifluoroethyl)hepta-3,5-dienyl]azepan-4-yl]methyl]-4-morpholin-4-ylcyclohepta-1,3,6-trien-1-amine;prop-1-yne (PubChem CID 143062154) has the molecular formula C34H53F4N3O and a molecular weight of 595.81 g/mol. Its IUPAC name is ethane;3-(fluoromethyl)-N-[[1-[(3E,5E)-3-methyl-5-(1,1,2-trifluoroethyl)hepta-3,5-dienyl]azepan-4-yl]methyl]-4-morpholin-4-ylcyclohepta-1,3,6-trien-1-amine;prop-1-yne.
| Compound Name | ethane;3-(fluoromethyl)-N-[[1-[(3E,5E)-3-methyl-5-(1,1,2-trifluoroethyl)hepta-3,5-dienyl]azepan-4-yl]methyl]-4-morpholin-4-ylcyclohepta-1,3,6-trien-1-amine;prop-1-yne |
|---|---|
| PubChem CID | 143062154 |
| Molecular Formula | C34H53F4N3O |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.41 |
| IUPAC Name | ethane;3-(fluoromethyl)-N-[[1-[(3E,5E)-3-methyl-5-(1,1,2-trifluoroethyl)hepta-3,5-dienyl]azepan-4-yl]methyl]-4-morpholin-4-ylcyclohepta-1,3,6-trien-1-amine;prop-1-yne |
| SMILES | C#CC.C/C=C(\C=C(/C)CCN1CCCC(CNC2=CC(CF)=C(N3CCOCC3)CC=C2)CC1)C(F)(F)CF.CC |
| InChI | InChI=1S/C29H43F4N3O.C3H4.C2H6/c1-3-26(29(32,33)22-31)18-23(2)9-12-35-11-5-6-24(10-13-35)21-34-27-7-4-8-28(25(19-27)20-30)36-14-16-37-17-15-36;1-3-2;1-2/h3-4,7,18-19,24,34H,5-6,8-17,20-22H2,1-2H3;1H,2H3;1-2H3/b23-18+,26-3+;; |
| InChIKey | FNYRVMYBVJOKJH-NEEDRBNKSA-N |
| XLogP | 7.63 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|