C23H19Cl3N2O3S — CID 143062271
2,4-dichloro-N-(4-chloro-3-methoxyphenyl)-N-[4-[(Z)-2-ethylbut-2-enoyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 143062271) has the molecular formula C23H19Cl3N2O3S and a molecular weight of 509.84 g/mol. Its IUPAC name is 2,4-dichloro-N-(4-chloro-3-methoxyphenyl)-N-[4-[(Z)-2-ethylbut-2-enoyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-(4-chloro-3-methoxyphenyl)-N-[4-[(Z)-2-ethylbut-2-enoyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 143062271 |
| Molecular Formula | C23H19Cl3N2O3S |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 2,4-dichloro-N-(4-chloro-3-methoxyphenyl)-N-[4-[(Z)-2-ethylbut-2-enoyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | C/C=C(/CC)C(=O)c1csc(N(C(=O)c2ccc(Cl)cc2Cl)c2ccc(Cl)c(OC)c2)n1 |
| InChI | InChI=1S/C23H19Cl3N2O3S/c1-4-13(5-2)21(29)19-12-32-23(27-19)28(15-7-9-17(25)20(11-15)31-3)22(30)16-8-6-14(24)10-18(16)26/h4,6-12H,5H2,1-3H3/b13-4- |
| InChIKey | FOIRYQJAQCYDMR-PQMHYQBVSA-N |
| XLogP | 7.63 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|