About (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine
(3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine (PubChem CID 143062399) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine.
Molecular Properties
| Compound Name | (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine |
| PubChem CID | 143062399 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine |
| SMILES | C=C(C)[C@H](CCCF)NC |
| InChI | InChI=1S/C8H16FN/c1-7(2)8(10-3)5-4-6-9/h8,10H,1,4-6H2,2-3H3/t8-/m0/s1 |
| InChIKey | ALQHOUCWQQADSQ-QMMMGPOBSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine?
The IUPAC name of (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine (CID 143062399) is (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine.
What is the SMILES notation for (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine?
The canonical SMILES for (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine is C=C(C)[C@H](CCCF)NC.
What is the InChIKey of (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine?
The InChIKey is ALQHOUCWQQADSQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16FN/c1-7(2)8(10-3)5-4-6-9/h8,10H,1,4-6H2,2-3H3/t8-/m0/s1.
What are the key properties of (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine?
(3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine has a molecular weight of 145.22 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-fluoro-N,2-dimethylhex-1-en-3-amine is sourced from PubChem (CID 143062399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).