C22H34N2O — CID 143062693
N-[4-[2-(11,11-dimethyl-4-azabicyclo[5.5.0]dodeca-1(12),7,9-trien-4-yl)ethyl]cyclohexyl]formamide (PubChem CID 143062693) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is N-[4-[2-(11,11-dimethyl-4-azabicyclo[5.5.0]dodeca-1(12),7,9-trien-4-yl)ethyl]cyclohexyl]formamide.
| Compound Name | N-[4-[2-(11,11-dimethyl-4-azabicyclo[5.5.0]dodeca-1(12),7,9-trien-4-yl)ethyl]cyclohexyl]formamide |
|---|---|
| PubChem CID | 143062693 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | N-[4-[2-(11,11-dimethyl-4-azabicyclo[5.5.0]dodeca-1(12),7,9-trien-4-yl)ethyl]cyclohexyl]formamide |
| SMILES | CC1(C)C=CC=C2CCN(CCC3CCC(NC=O)CC3)CCC2=C1 |
| InChI | InChI=1S/C22H34N2O/c1-22(2)12-3-4-19-10-14-24(15-11-20(19)16-22)13-9-18-5-7-21(8-6-18)23-17-25/h3-4,12,16-18,21H,5-11,13-15H2,1-2H3,(H,23,25) |
| InChIKey | JRIMJNYZPMIWKX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|