About 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine
4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine (PubChem CID 143062739) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine.
Molecular Properties
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine |
| PubChem CID | 143062739 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine |
| SMILES | C=C/C=C(\C=C)C1CCOCC1.CN |
| InChI | InChI=1S/C11H16O.CH5N/c1-3-5-10(4-2)11-6-8-12-9-7-11;1-2/h3-5,11H,1-2,6-9H2;2H2,1H3/b10-5+; |
| InChIKey | ZRMJMNDEISGFKD-OAZHBLANSA-N |
| XLogP | 2.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine?
The IUPAC name of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine (CID 143062739) is 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine.
What is the SMILES notation for 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine?
The canonical SMILES for 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine is C=C/C=C(\C=C)C1CCOCC1.CN.
What is the InChIKey of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine?
The InChIKey is ZRMJMNDEISGFKD-OAZHBLANSA-N. The full InChI is InChI=1S/C11H16O.CH5N/c1-3-5-10(4-2)11-6-8-12-9-7-11;1-2/h3-5,11H,1-2,6-9H2;2H2,1H3/b10-5+;.
What are the key properties of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine?
4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine has a molecular weight of 195.31 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane;methanamine is sourced from PubChem (CID 143062739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).