About ethane;formamide;4-methylcyclohexan-1-amine
ethane;formamide;4-methylcyclohexan-1-amine (PubChem CID 143062765) has the molecular formula C10H24N2O
and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;formamide;4-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | ethane;formamide;4-methylcyclohexan-1-amine |
| PubChem CID | 143062765 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethane;formamide;4-methylcyclohexan-1-amine |
| SMILES | CC.CC1CCC(N)CC1.NC=O |
| InChI | InChI=1S/C7H15N.C2H6.CH3NO/c1-6-2-4-7(8)5-3-6;1-2;2-1-3/h6-7H,2-5,8H2,1H3;1-2H3;1H,(H2,2,3) |
| InChIKey | XSBXUOOYJANHRR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formamide;4-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formamide;4-methylcyclohexan-1-amine?
The IUPAC name of ethane;formamide;4-methylcyclohexan-1-amine (CID 143062765) is ethane;formamide;4-methylcyclohexan-1-amine.
What is the SMILES notation for ethane;formamide;4-methylcyclohexan-1-amine?
The canonical SMILES for ethane;formamide;4-methylcyclohexan-1-amine is CC.CC1CCC(N)CC1.NC=O.
What is the InChIKey of ethane;formamide;4-methylcyclohexan-1-amine?
The InChIKey is XSBXUOOYJANHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C2H6.CH3NO/c1-6-2-4-7(8)5-3-6;1-2;2-1-3/h6-7H,2-5,8H2,1H3;1-2H3;1H,(H2,2,3).
What are the key properties of ethane;formamide;4-methylcyclohexan-1-amine?
ethane;formamide;4-methylcyclohexan-1-amine has a molecular weight of 188.31 g/mol, XLogP of 1.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formamide;4-methylcyclohexan-1-amine is sourced from PubChem (CID 143062765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).