About (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane
(2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane (PubChem CID 143062810) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane.
Molecular Properties
| Compound Name | (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane |
| PubChem CID | 143062810 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane |
| SMILES | C=C/C=C(\C=C)[C@@H](C)NC.COC |
| InChI | InChI=1S/C9H15N.C2H6O/c1-5-7-9(6-2)8(3)10-4;1-3-2/h5-8,10H,1-2H2,3-4H3;1-2H3/b9-7+;/t8-;/m1./s1 |
| InChIKey | DYXZHYZTWFKDQM-YBWOMNAPSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane?
The IUPAC name of (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane (CID 143062810) is (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane.
What is the SMILES notation for (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane?
The canonical SMILES for (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane is C=C/C=C(\C=C)[C@@H](C)NC.COC.
What is the InChIKey of (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane?
The InChIKey is DYXZHYZTWFKDQM-YBWOMNAPSA-N. The full InChI is InChI=1S/C9H15N.C2H6O/c1-5-7-9(6-2)8(3)10-4;1-3-2/h5-8,10H,1-2H2,3-4H3;1-2H3/b9-7+;/t8-;/m1./s1.
What are the key properties of (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane?
(2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane has a molecular weight of 183.29 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3E)-3-ethenyl-N-methylhexa-3,5-dien-2-amine;methoxymethane is sourced from PubChem (CID 143062810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).