C10H17Cl2N — CID 143063166
(2E,4Z)-1-chloro-N-ethylhepta-2,4,6-trien-3-amine;chloromethane (PubChem CID 143063166) has the molecular formula C10H17Cl2N and a molecular weight of 222.16 g/mol. Its IUPAC name is (2E,4Z)-1-chloro-N-ethylhepta-2,4,6-trien-3-amine;chloromethane.
| Compound Name | (2E,4Z)-1-chloro-N-ethylhepta-2,4,6-trien-3-amine;chloromethane |
|---|---|
| PubChem CID | 143063166 |
| Molecular Formula | C10H17Cl2N |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2E,4Z)-1-chloro-N-ethylhepta-2,4,6-trien-3-amine;chloromethane |
| SMILES | C=C/C=C\C(=C/CCl)NCC.CCl |
| InChI | InChI=1S/C9H14ClN.CH3Cl/c1-3-5-6-9(7-8-10)11-4-2;1-2/h3,5-7,11H,1,4,8H2,2H3;1H3/b6-5-,9-7+; |
| InChIKey | WRNUAKKDYFNVNU-HMERWLGPSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|