C39H62N6O4 — CID 143063223
ethyl 4-[N-[[2-[3-[2-ethoxyethyl(methyl)amino]propylamino]-3-methylbenzimidazol-5-yl]methyl]-3,5-dimethylanilino]butanoate;2-iminopropan-1-ol;(3E)-penta-1,3-diene (PubChem CID 143063223) has the molecular formula C39H62N6O4 and a molecular weight of 678.96 g/mol. Its IUPAC name is ethyl 4-[N-[[2-[3-[2-ethoxyethyl(methyl)amino]propylamino]-3-methylbenzimidazol-5-yl]methyl]-3,5-dimethylanilino]butanoate;2-iminopropan-1-ol;(3E)-penta-1,3-diene.
| Compound Name | ethyl 4-[N-[[2-[3-[2-ethoxyethyl(methyl)amino]propylamino]-3-methylbenzimidazol-5-yl]methyl]-3,5-dimethylanilino]butanoate;2-iminopropan-1-ol;(3E)-penta-1,3-diene |
|---|---|
| PubChem CID | 143063223 |
| Molecular Formula | C39H62N6O4 |
| Molecular Weight | 678.96 g/mol |
| Exact Mass | 678.48 |
| IUPAC Name | ethyl 4-[N-[[2-[3-[2-ethoxyethyl(methyl)amino]propylamino]-3-methylbenzimidazol-5-yl]methyl]-3,5-dimethylanilino]butanoate;2-iminopropan-1-ol;(3E)-penta-1,3-diene |
| SMILES | C=C/C=C/C.CCOCCN(C)CCCNc1nc2ccc(CN(CCCC(=O)OCC)c3cc(C)cc(C)c3)cc2n1C.[H]/N=C(\C)CO |
| InChI | InChI=1S/C31H47N5O3.C5H8.C3H7NO/c1-7-38-18-17-34(5)15-10-14-32-31-33-28-13-12-26(22-29(28)35(31)6)23-36(16-9-11-30(37)39-8-2)27-20-24(3)19-25(4)21-27;1-3-5-4-2;1-3(4)2-5/h12-13,19-22H,7-11,14-18,23H2,1-6H3,(H,32,33);3-5H,1H2,2H3;4-5H,2H2,1H3/b;5-4+;4-3+ |
| InChIKey | ZEMQWGHVLUMEHM-MBCNTBPQSA-N |
| XLogP | 7.08 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.96 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|