About N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine
N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine (PubChem CID 143063234) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine |
| PubChem CID | 143063234 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine |
| SMILES | CCNC1=C(CCCN(CC)CCOC)CC=CC=C1 |
| InChI | InChI=1S/C17H30N2O/c1-4-18-17-12-8-6-7-10-16(17)11-9-13-19(5-2)14-15-20-3/h6-8,12,18H,4-5,9-11,13-15H2,1-3H3 |
| InChIKey | PTIOVAXOXGLTFD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine?
The IUPAC name of N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine (CID 143063234) is N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine is CCNC1=C(CCCN(CC)CCOC)CC=CC=C1.
What is the InChIKey of N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine?
The InChIKey is PTIOVAXOXGLTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O/c1-4-18-17-12-8-6-7-10-16(17)11-9-13-19(5-2)14-15-20-3/h6-8,12,18H,4-5,9-11,13-15H2,1-3H3.
What are the key properties of N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine?
N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine has a molecular weight of 278.44 g/mol, XLogP of 3.11, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-[3-[ethyl(2-methoxyethyl)amino]propyl]cyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 143063234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).