About (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol
(4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol (PubChem CID 143063252) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol |
| PubChem CID | 143063252 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol |
| SMILES | CCN/C(C=C(C)C)=C(/C)CCCO |
| InChI | InChI=1S/C12H23NO/c1-5-13-12(9-10(2)3)11(4)7-6-8-14/h9,13-14H,5-8H2,1-4H3/b12-11- |
| InChIKey | MYGXAKODGZPSCA-QXMHVHEDSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol?
The IUPAC name of (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol (CID 143063252) is (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol.
What is the SMILES notation for (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol?
The canonical SMILES for (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol is CCN/C(C=C(C)C)=C(/C)CCCO.
What is the InChIKey of (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol?
The InChIKey is MYGXAKODGZPSCA-QXMHVHEDSA-N. The full InChI is InChI=1S/C12H23NO/c1-5-13-12(9-10(2)3)11(4)7-6-8-14/h9,13-14H,5-8H2,1-4H3/b12-11-.
What are the key properties of (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol?
(4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol has a molecular weight of 197.32 g/mol, XLogP of 2.61, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-5-(ethylamino)-4,7-dimethylocta-4,6-dien-1-ol is sourced from PubChem (CID 143063252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).