About 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine
4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine (PubChem CID 143063439) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine.
Molecular Properties
| Compound Name | 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine |
| PubChem CID | 143063439 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine |
| SMILES | C1=CC=C(CCN2CCOCC2)CC=C1.CCNC |
| InChI | InChI=1S/C13H19NO.C3H9N/c1-2-4-6-13(5-3-1)7-8-14-9-11-15-12-10-14;1-3-4-2/h1-5H,6-12H2;4H,3H2,1-2H3 |
| InChIKey | XTBLOSBYEMRDEU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine?
The IUPAC name of 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine (CID 143063439) is 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine.
What is the SMILES notation for 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine?
The canonical SMILES for 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine is C1=CC=C(CCN2CCOCC2)CC=C1.CCNC.
What is the InChIKey of 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine?
The InChIKey is XTBLOSBYEMRDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO.C3H9N/c1-2-4-6-13(5-3-1)7-8-14-9-11-15-12-10-14;1-3-4-2/h1-5H,6-12H2;4H,3H2,1-2H3.
What are the key properties of 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine?
4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine has a molecular weight of 264.41 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclohepta-1,3,5-trien-1-ylethyl)morpholine;N-methylethanamine is sourced from PubChem (CID 143063439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).