C13H21NO2 — CID 143064094
1-[(2S,3R)-1-acetyl-3-cyclopentylpyrrolidin-2-yl]ethanone (PubChem CID 143064094) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[(2S,3R)-1-acetyl-3-cyclopentylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2S,3R)-1-acetyl-3-cyclopentylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 143064094 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-[(2S,3R)-1-acetyl-3-cyclopentylpyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H](C2CCCC2)CCN1C(C)=O |
| InChI | InChI=1S/C13H21NO2/c1-9(15)13-12(11-5-3-4-6-11)7-8-14(13)10(2)16/h11-13H,3-8H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | BYVAENGJUXCOPP-CHWSQXEVSA-N |
| XLogP | 2.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |