About formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one
formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one (PubChem CID 143064192) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one |
| PubChem CID | 143064192 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC(C)C.CCC(=O)N1CCCC1C.O=CO |
| InChI | InChI=1S/C8H15NO.C4H10.CH2O2/c1-3-8(10)9-6-4-5-7(9)2;1-4(2)3;2-1-3/h7H,3-6H2,1-2H3;4H,1-3H3;1H,(H,2,3) |
| InChIKey | MHPQUEQERVZGSB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one?
The IUPAC name of formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one (CID 143064192) is formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one.
What is the SMILES notation for formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one?
The canonical SMILES for formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one is CC(C)C.CCC(=O)N1CCCC1C.O=CO.
What is the InChIKey of formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one?
The InChIKey is MHPQUEQERVZGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C4H10.CH2O2/c1-3-8(10)9-6-4-5-7(9)2;1-4(2)3;2-1-3/h7H,3-6H2,1-2H3;4H,1-3H3;1H,(H,2,3).
What are the key properties of formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one?
formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one has a molecular weight of 245.36 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;2-methylpropane;1-(2-methylpyrrolidin-1-yl)propan-1-one is sourced from PubChem (CID 143064192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).