C20H30N4O4S — CID 143064380
2-amino-5-methyl-5-(2-methylpropyl)-3-[[1-(2,4,6-trihydroxyphenyl)sulfanylpiperidin-4-yl]methyl]imidazol-4-one (PubChem CID 143064380) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-amino-5-methyl-5-(2-methylpropyl)-3-[[1-(2,4,6-trihydroxyphenyl)sulfanylpiperidin-4-yl]methyl]imidazol-4-one.
| Compound Name | 2-amino-5-methyl-5-(2-methylpropyl)-3-[[1-(2,4,6-trihydroxyphenyl)sulfanylpiperidin-4-yl]methyl]imidazol-4-one |
|---|---|
| PubChem CID | 143064380 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-amino-5-methyl-5-(2-methylpropyl)-3-[[1-(2,4,6-trihydroxyphenyl)sulfanylpiperidin-4-yl]methyl]imidazol-4-one |
| SMILES | CC(C)CC1(C)N=C(N)N(CC2CCN(Sc3c(O)cc(O)cc3O)CC2)C1=O |
| InChI | InChI=1S/C20H30N4O4S/c1-12(2)10-20(3)18(28)24(19(21)22-20)11-13-4-6-23(7-5-13)29-17-15(26)8-14(25)9-16(17)27/h8-9,12-13,25-27H,4-7,10-11H2,1-3H3,(H2,21,22) |
| InChIKey | GKJCBCOUEVIUOG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|