C20H39N5O2 — CID 143064660
4-[[[2-(1-aminoethylideneamino)-2,4-dimethylpentanoyl]amino]methyl]-N-tert-butylpiperidine-1-carboxamide (PubChem CID 143064660) has the molecular formula C20H39N5O2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 4-[[[2-(1-aminoethylideneamino)-2,4-dimethylpentanoyl]amino]methyl]-N-tert-butylpiperidine-1-carboxamide.
| Compound Name | 4-[[[2-(1-aminoethylideneamino)-2,4-dimethylpentanoyl]amino]methyl]-N-tert-butylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 143064660 |
| Molecular Formula | C20H39N5O2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | 4-[[[2-(1-aminoethylideneamino)-2,4-dimethylpentanoyl]amino]methyl]-N-tert-butylpiperidine-1-carboxamide |
| SMILES | C/C(N)=N\C(C)(CC(C)C)C(=O)NCC1CCN(C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H39N5O2/c1-14(2)12-20(7,23-15(3)21)17(26)22-13-16-8-10-25(11-9-16)18(27)24-19(4,5)6/h14,16H,8-13H2,1-7H3,(H2,21,23)(H,22,26)(H,24,27) |
| InChIKey | HVEJQXHQNKZBJC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|