About 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane
5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane (PubChem CID 143064661) has the molecular formula C23H45NO
and a molecular weight of 351.62 g/mol. Its IUPAC name is 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane.
Molecular Properties
| Compound Name | 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane |
| PubChem CID | 143064661 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane |
| SMILES | C=C(OC)C(N)CCC1CCCCC1.CCCCCC1CCCCC1 |
| InChI | InChI=1S/C12H23NO.C11H22/c1-10(14-2)12(13)9-8-11-6-4-3-5-7-11;1-2-3-5-8-11-9-6-4-7-10-11/h11-12H,1,3-9,13H2,2H3;11H,2-10H2,1H3 |
| InChIKey | SHFSWWMWZSIPKZ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane?
The IUPAC name of 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane (CID 143064661) is 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane.
What is the SMILES notation for 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane?
The canonical SMILES for 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane is C=C(OC)C(N)CCC1CCCCC1.CCCCCC1CCCCC1.
What is the InChIKey of 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane?
The InChIKey is SHFSWWMWZSIPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO.C11H22/c1-10(14-2)12(13)9-8-11-6-4-3-5-7-11;1-2-3-5-8-11-9-6-4-7-10-11/h11-12H,1,3-9,13H2,2H3;11H,2-10H2,1H3.
What are the key properties of 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane?
5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane has a molecular weight of 351.62 g/mol, XLogP of 6.98, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-2-methoxypent-1-en-3-amine;pentylcyclohexane is sourced from PubChem (CID 143064661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).