About 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid
2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid (PubChem CID 143065367) has the molecular formula C20H18F2N2O4S2
and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid |
| PubChem CID | 143065367 |
| Molecular Formula | C20H18F2N2O4S2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid |
| SMILES | CC(c1ccccc1)C(C)(NS(=O)(=O)c1ccc(-c2ncc(F)cc2F)s1)C(=O)O |
| InChI | InChI=1S/C20H18F2N2O4S2/c1-12(13-6-4-3-5-7-13)20(2,19(25)26)24-30(27,28)17-9-8-16(29-17)18-15(22)10-14(21)11-23-18/h3-12,24H,1-2H3,(H,25,26) |
| InChIKey | YLOIHABDJDQOQY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid?
The IUPAC name of 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid (CID 143065367) is 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid.
What is the SMILES notation for 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid?
The canonical SMILES for 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid is CC(c1ccccc1)C(C)(NS(=O)(=O)c1ccc(-c2ncc(F)cc2F)s1)C(=O)O.
What is the InChIKey of 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid?
The InChIKey is YLOIHABDJDQOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N2O4S2/c1-12(13-6-4-3-5-7-13)20(2,19(25)26)24-30(27,28)17-9-8-16(29-17)18-15(22)10-14(21)11-23-18/h3-12,24H,1-2H3,(H,25,26).
What are the key properties of 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid?
2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid has a molecular weight of 452.50 g/mol, XLogP of 4.01, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3,5-difluoro-2-pyridinyl)thiophen-2-yl]sulfonylamino]-2-methyl-3-phenylbutanoic acid is sourced from PubChem (CID 143065367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).