About CID 143065392
CID 143065392 (PubChem CID 143065392) has the molecular formula C19H21N2O3S2+
and a molecular weight of 389.52 g/mol.
Molecular Properties
| Compound Name | CID 143065392 |
| PubChem CID | 143065392 |
| Molecular Formula | C19H21N2O3S2+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | — |
| SMILES | O=C(O)C1(N[SH+](=O)c2ccc(C3=CCNCC3)s2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3S2/c22-18(23)19(12-15(19)13-4-2-1-3-5-13)21-26(24)17-7-6-16(25-17)14-8-10-20-11-9-14/h1-8,15,20H,9-12H2,(H,21,24)(H,22,23)/p+1/t15-,19?,26?/m1/s1 |
| InChIKey | CHTVTLPWFFMCEW-GTNZPDLFSA-O |
| XLogP | 2.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 143065392 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143065392?
The IUPAC name of CID 143065392 (CID 143065392) is not available.
What is the SMILES notation for CID 143065392?
The canonical SMILES for CID 143065392 is O=C(O)C1(N[SH+](=O)c2ccc(C3=CCNCC3)s2)C[C@@H]1c1ccccc1.
What is the InChIKey of CID 143065392?
The InChIKey is CHTVTLPWFFMCEW-GTNZPDLFSA-O. The full InChI is InChI=1S/C19H20N2O3S2/c22-18(23)19(12-15(19)13-4-2-1-3-5-13)21-26(24)17-7-6-16(25-17)14-8-10-20-11-9-14/h1-8,15,20H,9-12H2,(H,21,24)(H,22,23)/p+1/t15-,19?,26?/m1/s1.
What are the key properties of CID 143065392?
CID 143065392 has a molecular weight of 389.52 g/mol, XLogP of 2.70, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143065392 is sourced from PubChem (CID 143065392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).