C21H24ClN3O5S — CID 143065461
(2S)-2-benzyl-2-[[4-(4-chlorophenyl)-3-oxopiperazin-1-yl]sulfonylamino]butanoic acid (PubChem CID 143065461) has the molecular formula C21H24ClN3O5S and a molecular weight of 465.96 g/mol. Its IUPAC name is (2S)-2-benzyl-2-[[4-(4-chlorophenyl)-3-oxopiperazin-1-yl]sulfonylamino]butanoic acid.
| Compound Name | (2S)-2-benzyl-2-[[4-(4-chlorophenyl)-3-oxopiperazin-1-yl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 143065461 |
| Molecular Formula | C21H24ClN3O5S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (2S)-2-benzyl-2-[[4-(4-chlorophenyl)-3-oxopiperazin-1-yl]sulfonylamino]butanoic acid |
| SMILES | CC[C@@](Cc1ccccc1)(NS(=O)(=O)N1CCN(c2ccc(Cl)cc2)C(=O)C1)C(=O)O |
| InChI | InChI=1S/C21H24ClN3O5S/c1-2-21(20(27)28,14-16-6-4-3-5-7-16)23-31(29,30)24-12-13-25(19(26)15-24)18-10-8-17(22)9-11-18/h3-11,23H,2,12-15H2,1H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | REMBRDKTOAUWCD-NRFANRHFSA-N |
| XLogP | 2.30 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |